C31H32N2O4 — CID 10163768
1-cyclohexyl-2-[4-[2-(3-methylbut-2-enoxy)phenoxy]phenyl]benzimidazole-5-carboxylic acid (PubChem CID 10163768) has the molecular formula C31H32N2O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is 1-cyclohexyl-2-[4-[2-(3-methylbut-2-enoxy)phenoxy]phenyl]benzimidazole-5-carboxylic acid.
| Compound Name | 1-cyclohexyl-2-[4-[2-(3-methylbut-2-enoxy)phenoxy]phenyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 10163768 |
| Molecular Formula | C31H32N2O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 1-cyclohexyl-2-[4-[2-(3-methylbut-2-enoxy)phenoxy]phenyl]benzimidazole-5-carboxylic acid |
| SMILES | CC(C)=CCOc1ccccc1Oc1ccc(-c2nc3cc(C(=O)O)ccc3n2C2CCCCC2)cc1 |
| InChI | InChI=1S/C31H32N2O4/c1-21(2)18-19-36-28-10-6-7-11-29(28)37-25-15-12-22(13-16-25)30-32-26-20-23(31(34)35)14-17-27(26)33(30)24-8-4-3-5-9-24/h6-7,10-18,20,24H,3-5,8-9,19H2,1-2H3,(H,34,35) |
| InChIKey | OJZSKYOHXKCLKJ-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|