C31H27N3O3 — CID 23515648
1-cyclopentyl-2-[3-(naphthalen-1-ylmethylcarbamoyl)phenyl]benzimidazole-5-carboxylic acid (PubChem CID 23515648) has the molecular formula C31H27N3O3 and a molecular weight of 489.58 g/mol. Its IUPAC name is 1-cyclopentyl-2-[3-(naphthalen-1-ylmethylcarbamoyl)phenyl]benzimidazole-5-carboxylic acid.
| Compound Name | 1-cyclopentyl-2-[3-(naphthalen-1-ylmethylcarbamoyl)phenyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 23515648 |
| Molecular Formula | C31H27N3O3 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 1-cyclopentyl-2-[3-(naphthalen-1-ylmethylcarbamoyl)phenyl]benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(-c1cccc(C(=O)NCc3cccc4ccccc34)c1)n2C1CCCC1 |
| InChI | InChI=1S/C31H27N3O3/c35-30(32-19-24-11-5-8-20-7-1-4-14-26(20)24)22-10-6-9-21(17-22)29-33-27-18-23(31(36)37)15-16-28(27)34(29)25-12-2-3-13-25/h1,4-11,14-18,25H,2-3,12-13,19H2,(H,32,35)(H,36,37) |
| InChIKey | GXQSTZROHJKAEA-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |