C31H29N3O2 — CID 23515478
1-cyclohexyl-2-[3-[(naphthalen-1-ylamino)methyl]phenyl]benzimidazole-5-carboxylic acid (PubChem CID 23515478) has the molecular formula C31H29N3O2 and a molecular weight of 475.59 g/mol. Its IUPAC name is 1-cyclohexyl-2-[3-[(naphthalen-1-ylamino)methyl]phenyl]benzimidazole-5-carboxylic acid.
| Compound Name | 1-cyclohexyl-2-[3-[(naphthalen-1-ylamino)methyl]phenyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 23515478 |
| Molecular Formula | C31H29N3O2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 1-cyclohexyl-2-[3-[(naphthalen-1-ylamino)methyl]phenyl]benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(-c1cccc(CNc3cccc4ccccc34)c1)n2C1CCCCC1 |
| InChI | InChI=1S/C31H29N3O2/c35-31(36)24-16-17-29-28(19-24)33-30(34(29)25-12-2-1-3-13-25)23-11-6-8-21(18-23)20-32-27-15-7-10-22-9-4-5-14-26(22)27/h4-11,14-19,25,32H,1-3,12-13,20H2,(H,35,36) |
| InChIKey | METRWNKQPVFBBS-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |