C29H29Cl2N3O2 — CID 23515485
1-cyclohexyl-2-[3-[[2-(2,4-dichlorophenyl)ethylamino]methyl]phenyl]benzimidazole-5-carboxylic acid (PubChem CID 23515485) has the molecular formula C29H29Cl2N3O2 and a molecular weight of 522.48 g/mol. Its IUPAC name is 1-cyclohexyl-2-[3-[[2-(2,4-dichlorophenyl)ethylamino]methyl]phenyl]benzimidazole-5-carboxylic acid.
| Compound Name | 1-cyclohexyl-2-[3-[[2-(2,4-dichlorophenyl)ethylamino]methyl]phenyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 23515485 |
| Molecular Formula | C29H29Cl2N3O2 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 1-cyclohexyl-2-[3-[[2-(2,4-dichlorophenyl)ethylamino]methyl]phenyl]benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(-c1cccc(CNCCc3ccc(Cl)cc3Cl)c1)n2C1CCCCC1 |
| InChI | InChI=1S/C29H29Cl2N3O2/c30-23-11-9-20(25(31)17-23)13-14-32-18-19-5-4-6-21(15-19)28-33-26-16-22(29(35)36)10-12-27(26)34(28)24-7-2-1-3-8-24/h4-6,9-12,15-17,24,32H,1-3,7-8,13-14,18H2,(H,35,36) |
| InChIKey | VLQLRMBENFMMGL-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|