C29H32IN5O2 — CID 89380438
1-cyclohexyl-2-[3-[[4-(1,1-diamino-2-iodoethyl)anilino]methyl]phenyl]benzimidazole-5-carboxylic acid (PubChem CID 89380438) has the molecular formula C29H32IN5O2 and a molecular weight of 609.51 g/mol. Its IUPAC name is 1-cyclohexyl-2-[3-[[4-(1,1-diamino-2-iodoethyl)anilino]methyl]phenyl]benzimidazole-5-carboxylic acid.
| Compound Name | 1-cyclohexyl-2-[3-[[4-(1,1-diamino-2-iodoethyl)anilino]methyl]phenyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 89380438 |
| Molecular Formula | C29H32IN5O2 |
| Molecular Weight | 609.51 g/mol |
| Exact Mass | 609.16 |
| IUPAC Name | 1-cyclohexyl-2-[3-[[4-(1,1-diamino-2-iodoethyl)anilino]methyl]phenyl]benzimidazole-5-carboxylic acid |
| SMILES | NC(N)(CI)c1ccc(NCc2cccc(-c3nc4cc(C(=O)O)ccc4n3C3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C29H32IN5O2/c30-18-29(31,32)22-10-12-23(13-11-22)33-17-19-5-4-6-20(15-19)27-34-25-16-21(28(36)37)9-14-26(25)35(27)24-7-2-1-3-8-24/h4-6,9-16,24,33H,1-3,7-8,17-18,31-32H2,(H,36,37) |
| InChIKey | OJRDAGPEFBFGDU-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 119.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|