C34H33N3O2 — CID 23515899
2-[3-[(benzhydrylamino)methyl]phenyl]-1-cyclohexylbenzimidazole-5-carboxylic acid (PubChem CID 23515899) has the molecular formula C34H33N3O2 and a molecular weight of 515.66 g/mol. Its IUPAC name is 2-[3-[(benzhydrylamino)methyl]phenyl]-1-cyclohexylbenzimidazole-5-carboxylic acid.
| Compound Name | 2-[3-[(benzhydrylamino)methyl]phenyl]-1-cyclohexylbenzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 23515899 |
| Molecular Formula | C34H33N3O2 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | 2-[3-[(benzhydrylamino)methyl]phenyl]-1-cyclohexylbenzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(-c1cccc(CNC(c3ccccc3)c3ccccc3)c1)n2C1CCCCC1 |
| InChI | InChI=1S/C34H33N3O2/c38-34(39)28-19-20-31-30(22-28)36-33(37(31)29-17-8-3-9-18-29)27-16-10-11-24(21-27)23-35-32(25-12-4-1-5-13-25)26-14-6-2-7-15-26/h1-2,4-7,10-16,19-22,29,32,35H,3,8-9,17-18,23H2,(H,38,39) |
| InChIKey | HNHHRDUYIQJTEV-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |