C29H35N7O3 — CID 143663279
1-[(2S)-1-amino-5-[(1-aminocyclopropyl)amino]-1-oxopentan-2-yl]-N-methyl-2-(5-methylfuran-2-yl)-N-(2-pyridin-2-ylethyl)benzimidazole-5-carboxamide (PubChem CID 143663279) has the molecular formula C29H35N7O3 and a molecular weight of 529.65 g/mol. Its IUPAC name is 1-[(2S)-1-amino-5-[(1-aminocyclopropyl)amino]-1-oxopentan-2-yl]-N-methyl-2-(5-methylfuran-2-yl)-N-(2-pyridin-2-ylethyl)benzimidazole-5-carboxamide.
| Compound Name | 1-[(2S)-1-amino-5-[(1-aminocyclopropyl)amino]-1-oxopentan-2-yl]-N-methyl-2-(5-methylfuran-2-yl)-N-(2-pyridin-2-ylethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 143663279 |
| Molecular Formula | C29H35N7O3 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | 1-[(2S)-1-amino-5-[(1-aminocyclopropyl)amino]-1-oxopentan-2-yl]-N-methyl-2-(5-methylfuran-2-yl)-N-(2-pyridin-2-ylethyl)benzimidazole-5-carboxamide |
| SMILES | Cc1ccc(-c2nc3cc(C(=O)N(C)CCc4ccccn4)ccc3n2[C@@H](CCCNC2(N)CC2)C(N)=O)o1 |
| InChI | InChI=1S/C29H35N7O3/c1-19-8-11-25(39-19)27-34-22-18-20(28(38)35(2)17-12-21-6-3-4-15-32-21)9-10-23(22)36(27)24(26(30)37)7-5-16-33-29(31)13-14-29/h3-4,6,8-11,15,18,24,33H,5,7,12-14,16-17,31H2,1-2H3,(H2,30,37)/t24-/m0/s1 |
| InChIKey | VCEONBPLDGQTAZ-DEOSSOPVSA-N |
| XLogP | 3.16 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|