C33H32Cl2N8O3 — CID 59819649
1-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[3-(3,5-dichlorophenoxy)phenyl]-N-(2-pyridin-2-ylethyl)benzimidazole-5-carboxamide (PubChem CID 59819649) has the molecular formula C33H32Cl2N8O3 and a molecular weight of 659.58 g/mol. Its IUPAC name is 1-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[3-(3,5-dichlorophenoxy)phenyl]-N-(2-pyridin-2-ylethyl)benzimidazole-5-carboxamide.
| Compound Name | 1-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[3-(3,5-dichlorophenoxy)phenyl]-N-(2-pyridin-2-ylethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 59819649 |
| Molecular Formula | C33H32Cl2N8O3 |
| Molecular Weight | 659.58 g/mol |
| Exact Mass | 658.20 |
| IUPAC Name | 1-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[3-(3,5-dichlorophenoxy)phenyl]-N-(2-pyridin-2-ylethyl)benzimidazole-5-carboxamide |
| SMILES | NC(=O)[C@H](CCCN=C(N)N)n1c(-c2cccc(Oc3cc(Cl)cc(Cl)c3)c2)nc2cc(C(=O)NCCc3ccccn3)ccc21 |
| InChI | InChI=1S/C33H32Cl2N8O3/c34-22-17-23(35)19-26(18-22)46-25-7-3-5-20(15-25)31-42-27-16-21(32(45)40-14-11-24-6-1-2-12-39-24)9-10-28(27)43(31)29(30(36)44)8-4-13-41-33(37)38/h1-3,5-7,9-10,12,15-19,29H,4,8,11,13-14H2,(H2,36,44)(H,40,45)(H4,37,38,41)/t29-/m0/s1 |
| InChIKey | DCAHJERRFBSOFM-LJAQVGFWSA-N |
| XLogP | 5.25 |
| TPSA | 176.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|