C33H34N8O3 — CID 143663477
1-(2-amino-2-oxoethyl)-7-[1-(diaminomethylideneamino)propan-2-yl]-2-(3-phenoxyphenyl)-N-(2-pyridin-2-ylethyl)benzimidazole-5-carboxamide (PubChem CID 143663477) has the molecular formula C33H34N8O3 and a molecular weight of 590.69 g/mol. Its IUPAC name is 1-(2-amino-2-oxoethyl)-7-[1-(diaminomethylideneamino)propan-2-yl]-2-(3-phenoxyphenyl)-N-(2-pyridin-2-ylethyl)benzimidazole-5-carboxamide.
| Compound Name | 1-(2-amino-2-oxoethyl)-7-[1-(diaminomethylideneamino)propan-2-yl]-2-(3-phenoxyphenyl)-N-(2-pyridin-2-ylethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 143663477 |
| Molecular Formula | C33H34N8O3 |
| Molecular Weight | 590.69 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | 1-(2-amino-2-oxoethyl)-7-[1-(diaminomethylideneamino)propan-2-yl]-2-(3-phenoxyphenyl)-N-(2-pyridin-2-ylethyl)benzimidazole-5-carboxamide |
| SMILES | CC(CN=C(N)N)c1cc(C(=O)NCCc2ccccn2)cc2nc(-c3cccc(Oc4ccccc4)c3)n(CC(N)=O)c12 |
| InChI | InChI=1S/C33H34N8O3/c1-21(19-39-33(35)36)27-17-23(32(43)38-15-13-24-9-5-6-14-37-24)18-28-30(27)41(20-29(34)42)31(40-28)22-8-7-12-26(16-22)44-25-10-3-2-4-11-25/h2-12,14,16-18,21H,13,15,19-20H2,1H3,(H2,34,42)(H,38,43)(H4,35,36,39) |
| InChIKey | JWQFNFIFOJBQMY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 176.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.69 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|