C33H32ClN7O4 — CID 143663234
1-[(2R)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[3-(4-chlorophenoxy)phenyl]-N-(4-methoxyphenyl)benzimidazole-5-carboxamide (PubChem CID 143663234) has the molecular formula C33H32ClN7O4 and a molecular weight of 626.12 g/mol. Its IUPAC name is 1-[(2R)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[3-(4-chlorophenoxy)phenyl]-N-(4-methoxyphenyl)benzimidazole-5-carboxamide.
| Compound Name | 1-[(2R)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[3-(4-chlorophenoxy)phenyl]-N-(4-methoxyphenyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 143663234 |
| Molecular Formula | C33H32ClN7O4 |
| Molecular Weight | 626.12 g/mol |
| Exact Mass | 625.22 |
| IUPAC Name | 1-[(2R)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[3-(4-chlorophenoxy)phenyl]-N-(4-methoxyphenyl)benzimidazole-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc3c(c2)nc(-c2cccc(Oc4ccc(Cl)cc4)c2)n3[C@H](CCCN=C(N)N)C(N)=O)cc1 |
| InChI | InChI=1S/C33H32ClN7O4/c1-44-24-14-10-23(11-15-24)39-32(43)21-7-16-28-27(19-21)40-31(41(28)29(30(35)42)6-3-17-38-33(36)37)20-4-2-5-26(18-20)45-25-12-8-22(34)9-13-25/h2,4-5,7-16,18-19,29H,3,6,17H2,1H3,(H2,35,42)(H,39,43)(H4,36,37,38)/t29-/m1/s1 |
| InChIKey | MDNLDRXNZPTKHI-GDLZYMKVSA-N |
| XLogP | 5.49 |
| TPSA | 172.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.12 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|