C31H30N8O3 — CID 69228252
1-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-(3-phenoxyphenyl)-N-pyridin-4-ylbenzimidazole-5-carboxamide (PubChem CID 69228252) has the molecular formula C31H30N8O3 and a molecular weight of 562.63 g/mol. Its IUPAC name is 1-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-(3-phenoxyphenyl)-N-pyridin-4-ylbenzimidazole-5-carboxamide.
| Compound Name | 1-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-(3-phenoxyphenyl)-N-pyridin-4-ylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 69228252 |
| Molecular Formula | C31H30N8O3 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | 1-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-(3-phenoxyphenyl)-N-pyridin-4-ylbenzimidazole-5-carboxamide |
| SMILES | NC(=O)C(CCCN=C(N)N)n1c(-c2cccc(Oc3ccccc3)c2)nc2cc(C(=O)Nc3ccncc3)ccc21 |
| InChI | InChI=1S/C31H30N8O3/c32-28(40)27(10-5-15-36-31(33)34)39-26-12-11-21(30(41)37-22-13-16-35-17-14-22)19-25(26)38-29(39)20-6-4-9-24(18-20)42-23-7-2-1-3-8-23/h1-4,6-9,11-14,16-19,27H,5,10,15H2,(H2,32,40)(H4,33,34,36)(H,35,37,41) |
| InChIKey | AGCFGWRQBHYPNK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 176.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|