C29H28N8O3S — CID 89224505
1-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-(3-phenoxyphenyl)-N-(1,3-thiazol-2-yl)benzimidazole-5-carboxamide (PubChem CID 89224505) has the molecular formula C29H28N8O3S and a molecular weight of 568.66 g/mol. Its IUPAC name is 1-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-(3-phenoxyphenyl)-N-(1,3-thiazol-2-yl)benzimidazole-5-carboxamide.
| Compound Name | 1-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-(3-phenoxyphenyl)-N-(1,3-thiazol-2-yl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 89224505 |
| Molecular Formula | C29H28N8O3S |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | 1-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-(3-phenoxyphenyl)-N-(1,3-thiazol-2-yl)benzimidazole-5-carboxamide |
| SMILES | NC(=O)C(CCCN=C(N)N)n1c(-c2cccc(Oc3ccccc3)c2)nc2cc(C(=O)Nc3nccs3)ccc21 |
| InChI | InChI=1S/C29H28N8O3S/c30-25(38)24(10-5-13-33-28(31)32)37-23-12-11-19(27(39)36-29-34-14-15-41-29)17-22(23)35-26(37)18-6-4-9-21(16-18)40-20-7-2-1-3-8-20/h1-4,6-9,11-12,14-17,24H,5,10,13H2,(H2,30,38)(H4,31,32,33)(H,34,36,39) |
| InChIKey | DCTNXOXLHAANJR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 176.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|