C31H38N8O4 — CID 143663458
5-(1-aminoethenylamino)-2-[2-[5-(hydroxyamino)furan-2-yl]-5-[3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]benzimidazol-1-yl]pentanamide (PubChem CID 143663458) has the molecular formula C31H38N8O4 and a molecular weight of 586.70 g/mol. Its IUPAC name is 5-(1-aminoethenylamino)-2-[2-[5-(hydroxyamino)furan-2-yl]-5-[3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]benzimidazol-1-yl]pentanamide.
| Compound Name | 5-(1-aminoethenylamino)-2-[2-[5-(hydroxyamino)furan-2-yl]-5-[3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]benzimidazol-1-yl]pentanamide |
|---|---|
| PubChem CID | 143663458 |
| Molecular Formula | C31H38N8O4 |
| Molecular Weight | 586.70 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | 5-(1-aminoethenylamino)-2-[2-[5-(hydroxyamino)furan-2-yl]-5-[3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]benzimidazol-1-yl]pentanamide |
| SMILES | C=C(N)NCCCC(C(N)=O)n1c(-c2ccc(NO)o2)nc2cc(C(=O)N3CCN(c4cccc(C)c4)C(C)C3)ccc21 |
| InChI | InChI=1S/C31H38N8O4/c1-19-6-4-7-23(16-19)38-15-14-37(18-20(38)2)31(41)22-9-10-25-24(17-22)35-30(27-11-12-28(36-42)43-27)39(25)26(29(33)40)8-5-13-34-21(3)32/h4,6-7,9-12,16-17,20,26,34,36,42H,3,5,8,13-15,18,32H2,1-2H3,(H2,33,40) |
| InChIKey | LSUKLFZCYFGTHJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.70 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|