C33H36N8O2 — CID 89260326
2-[(4S)-4-[2-(3-cyanophenyl)-5-[3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]benzimidazol-1-yl]-5-oxopentyl]guanidine (PubChem CID 89260326) has the molecular formula C33H36N8O2 and a molecular weight of 576.71 g/mol. Its IUPAC name is 2-[(4S)-4-[2-(3-cyanophenyl)-5-[3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]benzimidazol-1-yl]-5-oxopentyl]guanidine.
| Compound Name | 2-[(4S)-4-[2-(3-cyanophenyl)-5-[3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]benzimidazol-1-yl]-5-oxopentyl]guanidine |
|---|---|
| PubChem CID | 89260326 |
| Molecular Formula | C33H36N8O2 |
| Molecular Weight | 576.71 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | 2-[(4S)-4-[2-(3-cyanophenyl)-5-[3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]benzimidazol-1-yl]-5-oxopentyl]guanidine |
| SMILES | Cc1cccc(N2CCN(C(=O)c3ccc4c(c3)nc(-c3cccc(C#N)c3)n4[C@H](C=O)CCCN=C(N)N)CC2C)c1 |
| InChI | InChI=1S/C33H36N8O2/c1-22-6-3-9-27(16-22)40-15-14-39(20-23(40)2)32(43)26-11-12-30-29(18-26)38-31(25-8-4-7-24(17-25)19-34)41(30)28(21-42)10-5-13-37-33(35)36/h3-4,6-9,11-12,16-18,21,23,28H,5,10,13-15,20H2,1-2H3,(H4,35,36,37)/t23?,28-/m0/s1 |
| InChIKey | AKMFJSAFQODXAF-WOKNPCPGSA-N |
| XLogP | 4.03 |
| TPSA | 146.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.71 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|