C34H42N8O2 — CID 143663410
methanamine;3-[5-[3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-1-(2-oxoethyl)benzimidazol-2-yl]benzonitrile;N'-propylmethanimidamide (PubChem CID 143663410) has the molecular formula C34H42N8O2 and a molecular weight of 594.76 g/mol. Its IUPAC name is methanamine;3-[5-[3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-1-(2-oxoethyl)benzimidazol-2-yl]benzonitrile;N'-propylmethanimidamide.
| Compound Name | methanamine;3-[5-[3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-1-(2-oxoethyl)benzimidazol-2-yl]benzonitrile;N'-propylmethanimidamide |
|---|---|
| PubChem CID | 143663410 |
| Molecular Formula | C34H42N8O2 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | methanamine;3-[5-[3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-1-(2-oxoethyl)benzimidazol-2-yl]benzonitrile;N'-propylmethanimidamide |
| SMILES | CCC/N=C/N.CN.Cc1cccc(N2CCN(C(=O)c3ccc4c(c3)nc(-c3cccc(C#N)c3)n4CC=O)CC2C)c1 |
| InChI | InChI=1S/C29H27N5O2.C4H10N2.CH5N/c1-20-5-3-8-25(15-20)33-12-11-32(19-21(33)2)29(36)24-9-10-27-26(17-24)31-28(34(27)13-14-35)23-7-4-6-22(16-23)18-30;1-2-3-6-4-5;1-2/h3-10,14-17,21H,11-13,19H2,1-2H3;4H,2-3H2,1H3,(H2,5,6);2H2,1H3 |
| InChIKey | ZBKNCVKZXUTJFA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 146.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|