C33H34FN9O2 — CID 143663450
2-[(4S)-4-[5-[4-(4-fluorophenyl)piperazine-1-carbonyl]-2-(2-phenyl-1H-imidazol-5-yl)benzimidazol-1-yl]-5-oxopentyl]guanidine (PubChem CID 143663450) has the molecular formula C33H34FN9O2 and a molecular weight of 607.69 g/mol. Its IUPAC name is 2-[(4S)-4-[5-[4-(4-fluorophenyl)piperazine-1-carbonyl]-2-(2-phenyl-1H-imidazol-5-yl)benzimidazol-1-yl]-5-oxopentyl]guanidine.
| Compound Name | 2-[(4S)-4-[5-[4-(4-fluorophenyl)piperazine-1-carbonyl]-2-(2-phenyl-1H-imidazol-5-yl)benzimidazol-1-yl]-5-oxopentyl]guanidine |
|---|---|
| PubChem CID | 143663450 |
| Molecular Formula | C33H34FN9O2 |
| Molecular Weight | 607.69 g/mol |
| Exact Mass | 607.28 |
| IUPAC Name | 2-[(4S)-4-[5-[4-(4-fluorophenyl)piperazine-1-carbonyl]-2-(2-phenyl-1H-imidazol-5-yl)benzimidazol-1-yl]-5-oxopentyl]guanidine |
| SMILES | NC(N)=NCCC[C@@H](C=O)n1c(-c2cnc(-c3ccccc3)[nH]2)nc2cc(C(=O)N3CCN(c4ccc(F)cc4)CC3)ccc21 |
| InChI | InChI=1S/C33H34FN9O2/c34-24-9-11-25(12-10-24)41-15-17-42(18-16-41)32(45)23-8-13-29-27(19-23)40-31(43(29)26(21-44)7-4-14-37-33(35)36)28-20-38-30(39-28)22-5-2-1-3-6-22/h1-3,5-6,8-13,19-21,26H,4,7,14-18H2,(H,38,39)(H4,35,36,37)/t26-/m0/s1 |
| InChIKey | VDIHOTLSHQPLBA-SANMLTNESA-N |
| XLogP | 3.99 |
| TPSA | 151.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.69 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|