C29H28FN5O3 — CID 57411696
4-[[7-[4-(4-fluorophenyl)piperazine-1-carbonyl]-3-phenylquinoxalin-2-yl]amino]butanoic acid (PubChem CID 57411696) has the molecular formula C29H28FN5O3 and a molecular weight of 513.57 g/mol. Its IUPAC name is 4-[[7-[4-(4-fluorophenyl)piperazine-1-carbonyl]-3-phenylquinoxalin-2-yl]amino]butanoic acid.
| Compound Name | 4-[[7-[4-(4-fluorophenyl)piperazine-1-carbonyl]-3-phenylquinoxalin-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 57411696 |
| Molecular Formula | C29H28FN5O3 |
| Molecular Weight | 513.57 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 4-[[7-[4-(4-fluorophenyl)piperazine-1-carbonyl]-3-phenylquinoxalin-2-yl]amino]butanoic acid |
| SMILES | O=C(O)CCCNc1nc2cc(C(=O)N3CCN(c4ccc(F)cc4)CC3)ccc2nc1-c1ccccc1 |
| InChI | InChI=1S/C29H28FN5O3/c30-22-9-11-23(12-10-22)34-15-17-35(18-16-34)29(38)21-8-13-24-25(19-21)33-28(31-14-4-7-26(36)37)27(32-24)20-5-2-1-3-6-20/h1-3,5-6,8-13,19H,4,7,14-18H2,(H,31,33)(H,36,37) |
| InChIKey | YLGGKIXDLNCBDG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|