C36H49FN8O2 — CID 143663417
[1-[(E)-2-aminopent-2-enyl]-2-(3-methoxyphenyl)benzimidazol-5-yl]-[4-(4-fluorophenyl)piperazin-1-yl]methanone;ethane;2-propylguanidine (PubChem CID 143663417) has the molecular formula C36H49FN8O2 and a molecular weight of 644.84 g/mol. Its IUPAC name is [1-[(E)-2-aminopent-2-enyl]-2-(3-methoxyphenyl)benzimidazol-5-yl]-[4-(4-fluorophenyl)piperazin-1-yl]methanone;ethane;2-propylguanidine.
| Compound Name | [1-[(E)-2-aminopent-2-enyl]-2-(3-methoxyphenyl)benzimidazol-5-yl]-[4-(4-fluorophenyl)piperazin-1-yl]methanone;ethane;2-propylguanidine |
|---|---|
| PubChem CID | 143663417 |
| Molecular Formula | C36H49FN8O2 |
| Molecular Weight | 644.84 g/mol |
| Exact Mass | 644.40 |
| IUPAC Name | [1-[(E)-2-aminopent-2-enyl]-2-(3-methoxyphenyl)benzimidazol-5-yl]-[4-(4-fluorophenyl)piperazin-1-yl]methanone;ethane;2-propylguanidine |
| SMILES | CC.CC/C=C(/N)Cn1c(-c2cccc(OC)c2)nc2cc(C(=O)N3CCN(c4ccc(F)cc4)CC3)ccc21.CCCN=C(N)N |
| InChI | InChI=1S/C30H32FN5O2.C4H11N3.C2H6/c1-3-5-24(32)20-36-28-13-8-22(19-27(28)33-29(36)21-6-4-7-26(18-21)38-2)30(37)35-16-14-34(15-17-35)25-11-9-23(31)10-12-25;1-2-3-7-4(5)6;1-2/h4-13,18-19H,3,14-17,20,32H2,1-2H3;2-3H2,1H3,(H4,5,6,7);1-2H3/b24-5+;; |
| InChIKey | AZKSCIUKGAOSJO-ZGWMFPSGSA-N |
| XLogP | 5.76 |
| TPSA | 141.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.84 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|