C21H28FIN4O — CID 111099363
4-(4-fluorophenyl)-N'-[3-(3-methoxyphenyl)propyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111099363) has the molecular formula C21H28FIN4O and a molecular weight of 498.38 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[3-(3-methoxyphenyl)propyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-fluorophenyl)-N'-[3-(3-methoxyphenyl)propyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111099363 |
| Molecular Formula | C21H28FIN4O |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[3-(3-methoxyphenyl)propyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | COc1cccc(CCC/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)c1.I |
| InChI | InChI=1S/C21H27FN4O.HI/c1-27-20-6-2-4-17(16-20)5-3-11-24-21(23)26-14-12-25(13-15-26)19-9-7-18(22)8-10-19;/h2,4,6-10,16H,3,5,11-15H2,1H3,(H2,23,24);1H |
| InChIKey | CBOGWDFWUSQNQE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|