C33H30ClN3O — CID 69082634
N-benzyl-2-[2-(4-chlorophenyl)benzimidazol-1-yl]-2-cyclopentyl-N-phenylacetamide (PubChem CID 69082634) has the molecular formula C33H30ClN3O and a molecular weight of 520.08 g/mol. Its IUPAC name is N-benzyl-2-[2-(4-chlorophenyl)benzimidazol-1-yl]-2-cyclopentyl-N-phenylacetamide.
| Compound Name | N-benzyl-2-[2-(4-chlorophenyl)benzimidazol-1-yl]-2-cyclopentyl-N-phenylacetamide |
|---|---|
| PubChem CID | 69082634 |
| Molecular Formula | C33H30ClN3O |
| Molecular Weight | 520.08 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | N-benzyl-2-[2-(4-chlorophenyl)benzimidazol-1-yl]-2-cyclopentyl-N-phenylacetamide |
| SMILES | O=C(C(C1CCCC1)n1c(-c2ccc(Cl)cc2)nc2ccccc21)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H30ClN3O/c34-27-21-19-26(20-22-27)32-35-29-17-9-10-18-30(29)37(32)31(25-13-7-8-14-25)33(38)36(28-15-5-2-6-16-28)23-24-11-3-1-4-12-24/h1-6,9-12,15-22,25,31H,7-8,13-14,23H2 |
| InChIKey | KTBGPOJTQLMXPT-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.08 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |