C18H19N — CID 101113448
4-[3-(1,1-dideuteriopentyl)phenyl]benzonitrile (PubChem CID 101113448) has the molecular formula C18H19N and a molecular weight of 251.37 g/mol. Its IUPAC name is 4-[3-(1,1-dideuteriopentyl)phenyl]benzonitrile.
| Compound Name | 4-[3-(1,1-dideuteriopentyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 101113448 |
| Molecular Formula | C18H19N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 4-[3-(1,1-dideuteriopentyl)phenyl]benzonitrile |
| SMILES | [2H]C([2H])(CCCC)c1cccc(-c2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C18H19N/c1-2-3-4-6-15-7-5-8-18(13-15)17-11-9-16(14-19)10-12-17/h5,7-13H,2-4,6H2,1H3/i6D2 |
| InChIKey | DHPPFPVLUBMWFO-NCYHJHSESA-N |
| XLogP | 4.96 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |