C27H28OSi — CID 101115081
(2E,4Z)-1-triphenylsilylnona-2,4-dien-1-one (PubChem CID 101115081) has the molecular formula C27H28OSi and a molecular weight of 396.61 g/mol. Its IUPAC name is (2E,4Z)-1-triphenylsilylnona-2,4-dien-1-one.
| Compound Name | (2E,4Z)-1-triphenylsilylnona-2,4-dien-1-one |
|---|---|
| PubChem CID | 101115081 |
| Molecular Formula | C27H28OSi |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | (2E,4Z)-1-triphenylsilylnona-2,4-dien-1-one |
| SMILES | CCCC/C=C\C=C\C(=O)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H28OSi/c1-2-3-4-5-6-16-23-27(28)29(24-17-10-7-11-18-24,25-19-12-8-13-20-25)26-21-14-9-15-22-26/h5-23H,2-4H2,1H3/b6-5-,23-16+ |
| InChIKey | NNXITTGIWCFWPK-MLBGHKHTSA-N |
| XLogP | 4.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|