C19H24O5 — CID 101115380
[(4R,5S)-4-acetyloxy-2,6,6,9-tetramethyl-11-oxo-5-tricyclo[5.4.0.04,8]undeca-2,9-dienyl] acetate (PubChem CID 101115380) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is [(4R,5S)-4-acetyloxy-2,6,6,9-tetramethyl-11-oxo-5-tricyclo[5.4.0.04,8]undeca-2,9-dienyl] acetate.
| Compound Name | [(4R,5S)-4-acetyloxy-2,6,6,9-tetramethyl-11-oxo-5-tricyclo[5.4.0.04,8]undeca-2,9-dienyl] acetate |
|---|---|
| PubChem CID | 101115380 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | [(4R,5S)-4-acetyloxy-2,6,6,9-tetramethyl-11-oxo-5-tricyclo[5.4.0.04,8]undeca-2,9-dienyl] acetate |
| SMILES | CC(=O)O[C@H]1C(C)(C)C2C3C(=O)C=C(C)C2[C@]1(OC(C)=O)C=C3C |
| InChI | InChI=1S/C19H24O5/c1-9-7-13(22)14-10(2)8-19(24-12(4)21)15(9)16(14)18(5,6)17(19)23-11(3)20/h7-8,14-17H,1-6H3/t14?,15?,16?,17-,19+/m0/s1 |
| InChIKey | PJVMRIITHICUBE-ILCLNCQGSA-N |
| XLogP | 2.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|