C17H31NO2 — CID 101115967
tert-butyl (12Z)-1-azacyclotridec-12-ene-1-carboxylate (PubChem CID 101115967) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is tert-butyl (12Z)-1-azacyclotridec-12-ene-1-carboxylate.
| Compound Name | tert-butyl (12Z)-1-azacyclotridec-12-ene-1-carboxylate |
|---|---|
| PubChem CID | 101115967 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | tert-butyl (12Z)-1-azacyclotridec-12-ene-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1/C=C\CCCCCCCCCC1 |
| InChI | InChI=1S/C17H31NO2/c1-17(2,3)20-16(19)18-14-12-10-8-6-4-5-7-9-11-13-15-18/h12,14H,4-11,13,15H2,1-3H3/b14-12- |
| InChIKey | ISWWTBDZNVRABW-OWBHPGMISA-N |
| XLogP | 5.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |