C15H13BrClNO5 — CID 10111746
2-(4-bromo-2-chloroanilino)-2-(4-methoxycarbonyl-5-methylfuran-2-yl)acetic acid (PubChem CID 10111746) has the molecular formula C15H13BrClNO5 and a molecular weight of 402.63 g/mol. Its IUPAC name is 2-(4-bromo-2-chloroanilino)-2-(4-methoxycarbonyl-5-methylfuran-2-yl)acetic acid.
| Compound Name | 2-(4-bromo-2-chloroanilino)-2-(4-methoxycarbonyl-5-methylfuran-2-yl)acetic acid |
|---|---|
| PubChem CID | 10111746 |
| Molecular Formula | C15H13BrClNO5 |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | 2-(4-bromo-2-chloroanilino)-2-(4-methoxycarbonyl-5-methylfuran-2-yl)acetic acid |
| SMILES | COC(=O)c1cc(C(Nc2ccc(Br)cc2Cl)C(=O)O)oc1C |
| InChI | InChI=1S/C15H13BrClNO5/c1-7-9(15(21)22-2)6-12(23-7)13(14(19)20)18-11-4-3-8(16)5-10(11)17/h3-6,13,18H,1-2H3,(H,19,20) |
| InChIKey | ZXEORFNLLGDMJY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |