C15H23NO2Si — CID 101119733
(6R,7S,8S)-7-(2-trimethylsilylethynyl)spiro[1,2,3,5,7,8-hexahydropyrrolizine-6,3'-oxolane]-2'-one (PubChem CID 101119733) has the molecular formula C15H23NO2Si and a molecular weight of 277.44 g/mol. Its IUPAC name is (6R,7S,8S)-7-(2-trimethylsilylethynyl)spiro[1,2,3,5,7,8-hexahydropyrrolizine-6,3'-oxolane]-2'-one.
| Compound Name | (6R,7S,8S)-7-(2-trimethylsilylethynyl)spiro[1,2,3,5,7,8-hexahydropyrrolizine-6,3'-oxolane]-2'-one |
|---|---|
| PubChem CID | 101119733 |
| Molecular Formula | C15H23NO2Si |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (6R,7S,8S)-7-(2-trimethylsilylethynyl)spiro[1,2,3,5,7,8-hexahydropyrrolizine-6,3'-oxolane]-2'-one |
| SMILES | C[Si](C)(C)C#C[C@H]1[C@@H]2CCCN2C[C@@]12CCOC2=O |
| InChI | InChI=1S/C15H23NO2Si/c1-19(2,3)10-6-12-13-5-4-8-16(13)11-15(12)7-9-18-14(15)17/h12-13H,4-5,7-9,11H2,1-3H3/t12-,13-,15-/m0/s1 |
| InChIKey | CAIXLOFZQMIRIM-YDHLFZDLSA-N |
| XLogP | 1.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|