C10H15NO2 — CID 23244200
(6S,8S)-spiro[1,2,3,5,7,8-hexahydropyrrolizine-6,3'-oxolane]-2'-one (PubChem CID 23244200) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (6S,8S)-spiro[1,2,3,5,7,8-hexahydropyrrolizine-6,3'-oxolane]-2'-one.
| Compound Name | (6S,8S)-spiro[1,2,3,5,7,8-hexahydropyrrolizine-6,3'-oxolane]-2'-one |
|---|---|
| PubChem CID | 23244200 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (6S,8S)-spiro[1,2,3,5,7,8-hexahydropyrrolizine-6,3'-oxolane]-2'-one |
| SMILES | O=C1OCC[C@]12C[C@@H]1CCCN1C2 |
| InChI | InChI=1S/C10H15NO2/c12-9-10(3-5-13-9)6-8-2-1-4-11(8)7-10/h8H,1-7H2/t8-,10+/m0/s1 |
| InChIKey | SLOWXVBJJVLAJZ-WCBMZHEXSA-N |
| XLogP | 0.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |