C14H23NO2 — CID 7201286
ethyl (1S,8S)-spiro[1,2,5,6,7,8-hexahydropyrrolizine-3,1'-cyclopentane]-1-carboxylate (PubChem CID 7201286) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is ethyl (1S,8S)-spiro[1,2,5,6,7,8-hexahydropyrrolizine-3,1'-cyclopentane]-1-carboxylate.
| Compound Name | ethyl (1S,8S)-spiro[1,2,5,6,7,8-hexahydropyrrolizine-3,1'-cyclopentane]-1-carboxylate |
|---|---|
| PubChem CID | 7201286 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | ethyl (1S,8S)-spiro[1,2,5,6,7,8-hexahydropyrrolizine-3,1'-cyclopentane]-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC2(CCCC2)N2CCC[C@@H]12 |
| InChI | InChI=1S/C14H23NO2/c1-2-17-13(16)11-10-14(7-3-4-8-14)15-9-5-6-12(11)15/h11-12H,2-10H2,1H3/t11-,12-/m0/s1 |
| InChIKey | SQVGKJHPVVUQEZ-RYUDHWBXSA-N |
| XLogP | 2.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |