C11H15NO2 — CID 101119746
(6R,8S)-7-methylidenespiro[2,3,5,8-tetrahydro-1H-pyrrolizine-6,3'-oxolane]-2'-one (PubChem CID 101119746) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (6R,8S)-7-methylidenespiro[2,3,5,8-tetrahydro-1H-pyrrolizine-6,3'-oxolane]-2'-one.
| Compound Name | (6R,8S)-7-methylidenespiro[2,3,5,8-tetrahydro-1H-pyrrolizine-6,3'-oxolane]-2'-one |
|---|---|
| PubChem CID | 101119746 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (6R,8S)-7-methylidenespiro[2,3,5,8-tetrahydro-1H-pyrrolizine-6,3'-oxolane]-2'-one |
| SMILES | C=C1[C@@H]2CCCN2C[C@@]12CCOC2=O |
| InChI | InChI=1S/C11H15NO2/c1-8-9-3-2-5-12(9)7-11(8)4-6-14-10(11)13/h9H,1-7H2/t9-,11-/m0/s1 |
| InChIKey | SOZWUANXDKLMRZ-ONGXEEELSA-N |
| XLogP | 0.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|