C13H16O3 — CID 101120537
(4'aR,8'S,8'aS)-8'-methylspiro[1,3-dioxolane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one (PubChem CID 101120537) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is (4'aR,8'S,8'aS)-8'-methylspiro[1,3-dioxolane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one.
| Compound Name | (4'aR,8'S,8'aS)-8'-methylspiro[1,3-dioxolane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 101120537 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (4'aR,8'S,8'aS)-8'-methylspiro[1,3-dioxolane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one |
| SMILES | C[C@H]1C=CC[C@@H]2[C@H]1C(=O)C=CC21OCCO1 |
| InChI | InChI=1S/C13H16O3/c1-9-3-2-4-10-12(9)11(14)5-6-13(10)15-7-8-16-13/h2-3,5-6,9-10,12H,4,7-8H2,1H3/t9-,10+,12-/m0/s1 |
| InChIKey | BSBNNZGXUMNXHJ-UMNHJUIQSA-N |
| XLogP | 1.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|