C18H18Cl2LiNO3 — CID 101120665
lithium 2-[[(3S)-3-(3,4-dichlorophenoxy)-3-phenylpropyl]-methylamino]acetate (PubChem CID 101120665) has the molecular formula C18H18Cl2LiNO3 and a molecular weight of 374.19 g/mol. Its IUPAC name is lithium 2-[[(3S)-3-(3,4-dichlorophenoxy)-3-phenylpropyl]-methylamino]acetate.
| Compound Name | lithium 2-[[(3S)-3-(3,4-dichlorophenoxy)-3-phenylpropyl]-methylamino]acetate |
|---|---|
| PubChem CID | 101120665 |
| Molecular Formula | C18H18Cl2LiNO3 |
| Molecular Weight | 374.19 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | lithium 2-[[(3S)-3-(3,4-dichlorophenoxy)-3-phenylpropyl]-methylamino]acetate |
| SMILES | CN(CC[C@H](Oc1ccc(Cl)c(Cl)c1)c1ccccc1)CC(=O)[O-].[Li+] |
| InChI | InChI=1S/C18H19Cl2NO3.Li/c1-21(12-18(22)23)10-9-17(13-5-3-2-4-6-13)24-14-7-8-15(19)16(20)11-14;/h2-8,11,17H,9-10,12H2,1H3,(H,22,23);/q;+1/p-1/t17-;/m0./s1 |
| InChIKey | MVYWOTWVDOEODY-LMOVPXPDSA-M |
| XLogP | 0.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.19 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |