C24H27NO3 — CID 21019935
ethyl 2-[methyl-(3-naphthalen-2-yloxy-3-phenylpropyl)amino]acetate (PubChem CID 21019935) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is ethyl 2-[methyl-(3-naphthalen-2-yloxy-3-phenylpropyl)amino]acetate.
| Compound Name | ethyl 2-[methyl-(3-naphthalen-2-yloxy-3-phenylpropyl)amino]acetate |
|---|---|
| PubChem CID | 21019935 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | ethyl 2-[methyl-(3-naphthalen-2-yloxy-3-phenylpropyl)amino]acetate |
| SMILES | CCOC(=O)CN(C)CCC(Oc1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C24H27NO3/c1-3-27-24(26)18-25(2)16-15-23(20-10-5-4-6-11-20)28-22-14-13-19-9-7-8-12-21(19)17-22/h4-14,17,23H,3,15-16,18H2,1-2H3 |
| InChIKey | XIVYKEKZSRMEPH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |