C33H47N3O4 — CID 101121104
methyl 2-[[4-benzyl-2-[1-[benzyl(5-hydroxypentyl)amino]heptyl]-1,3-oxazol-5-yl]-methylamino]acetate (PubChem CID 101121104) has the molecular formula C33H47N3O4 and a molecular weight of 549.76 g/mol. Its IUPAC name is methyl 2-[[4-benzyl-2-[1-[benzyl(5-hydroxypentyl)amino]heptyl]-1,3-oxazol-5-yl]-methylamino]acetate.
| Compound Name | methyl 2-[[4-benzyl-2-[1-[benzyl(5-hydroxypentyl)amino]heptyl]-1,3-oxazol-5-yl]-methylamino]acetate |
|---|---|
| PubChem CID | 101121104 |
| Molecular Formula | C33H47N3O4 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.36 |
| IUPAC Name | methyl 2-[[4-benzyl-2-[1-[benzyl(5-hydroxypentyl)amino]heptyl]-1,3-oxazol-5-yl]-methylamino]acetate |
| SMILES | CCCCCCC(c1nc(Cc2ccccc2)c(N(C)CC(=O)OC)o1)N(CCCCCO)Cc1ccccc1 |
| InChI | InChI=1S/C33H47N3O4/c1-4-5-6-14-21-30(36(22-15-9-16-23-37)25-28-19-12-8-13-20-28)32-34-29(24-27-17-10-7-11-18-27)33(40-32)35(2)26-31(38)39-3/h7-8,10-13,17-20,30,37H,4-6,9,14-16,21-26H2,1-3H3 |
| InChIKey | JWXVUOZODURCQA-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|