C27H39N3O2 — CID 102270460
1-(4-benzyl-5-morpholin-4-yl-1,3-oxazol-2-yl)-N,N-bis(prop-2-enyl)heptan-1-amine (PubChem CID 102270460) has the molecular formula C27H39N3O2 and a molecular weight of 437.63 g/mol. Its IUPAC name is 1-(4-benzyl-5-morpholin-4-yl-1,3-oxazol-2-yl)-N,N-bis(prop-2-enyl)heptan-1-amine.
| Compound Name | 1-(4-benzyl-5-morpholin-4-yl-1,3-oxazol-2-yl)-N,N-bis(prop-2-enyl)heptan-1-amine |
|---|---|
| PubChem CID | 102270460 |
| Molecular Formula | C27H39N3O2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | 1-(4-benzyl-5-morpholin-4-yl-1,3-oxazol-2-yl)-N,N-bis(prop-2-enyl)heptan-1-amine |
| SMILES | C=CCN(CC=C)C(CCCCCC)c1nc(Cc2ccccc2)c(N2CCOCC2)o1 |
| InChI | InChI=1S/C27H39N3O2/c1-4-7-8-12-15-25(29(16-5-2)17-6-3)26-28-24(22-23-13-10-9-11-14-23)27(32-26)30-18-20-31-21-19-30/h5-6,9-11,13-14,25H,2-4,7-8,12,15-22H2,1H3 |
| InChIKey | AXSCFRICRKFISX-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|