C30H50O3 — CID 101121171
(1R,2R,5R,7S,10R,11R,14R,15S,16S,17R,19R,21S,22S)-1,2,6,6,10,16,17,21-octamethyl-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricosane-7,22-diol (PubChem CID 101121171) has the molecular formula C30H50O3 and a molecular weight of 458.73 g/mol. Its IUPAC name is (1R,2R,5R,7S,10R,11R,14R,15S,16S,17R,19R,21S,22S)-1,2,6,6,10,16,17,21-octamethyl-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricosane-7,22-diol.
| Compound Name | (1R,2R,5R,7S,10R,11R,14R,15S,16S,17R,19R,21S,22S)-1,2,6,6,10,16,17,21-octamethyl-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricosane-7,22-diol |
|---|---|
| PubChem CID | 101121171 |
| Molecular Formula | C30H50O3 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 458.38 |
| IUPAC Name | (1R,2R,5R,7S,10R,11R,14R,15S,16S,17R,19R,21S,22S)-1,2,6,6,10,16,17,21-octamethyl-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricosane-7,22-diol |
| SMILES | C[C@H]1[C@@H]2[C@H]3CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)C[C@H](O)[C@@]2(C)C[C@H]2O[C@@]21C |
| InChI | InChI=1S/C30H50O3/c1-17-24-18-9-10-20-26(4)13-12-21(31)25(2,3)19(26)11-14-28(20,6)29(18,7)15-22(32)27(24,5)16-23-30(17,8)33-23/h17-24,31-32H,9-16H2,1-8H3/t17-,18+,19-,20+,21-,22-,23+,24+,26-,27+,28+,29+,30+/m0/s1 |
| InChIKey | ZHBSMFWWAZGXHE-JYTKYFAUSA-N |
| XLogP | 6.21 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|