C29H48O3 — CID 163094607
1,6,6,10,16,17,21-heptamethyl-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricosane-7,22-diol (PubChem CID 163094607) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is 1,6,6,10,16,17,21-heptamethyl-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricosane-7,22-diol.
| Compound Name | 1,6,6,10,16,17,21-heptamethyl-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricosane-7,22-diol |
|---|---|
| PubChem CID | 163094607 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | 1,6,6,10,16,17,21-heptamethyl-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricosane-7,22-diol |
| SMILES | CC1C2C3CCC4C(CCC5C(C)(C)C(O)CCC45C)C3(C)CC(O)C2(C)CC2OC21C |
| InChI | InChI=1S/C29H48O3/c1-16-24-19-9-8-17-18(10-11-20-25(2,3)21(30)12-13-26(17,20)4)27(19,5)14-22(31)28(24,6)15-23-29(16,7)32-23/h16-24,30-31H,8-15H2,1-7H3 |
| InChIKey | MGMHZMXSQXUWHL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|