C30H52O3 — CID 144908713
(5aR)-3a,5a,8,8,11a-pentamethyl-2,3,4,5,5b,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-ol;formic acid;prop-1-ene (PubChem CID 144908713) has the molecular formula C30H52O3 and a molecular weight of 460.74 g/mol. Its IUPAC name is (5aR)-3a,5a,8,8,11a-pentamethyl-2,3,4,5,5b,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-ol;formic acid;prop-1-ene.
| Compound Name | (5aR)-3a,5a,8,8,11a-pentamethyl-2,3,4,5,5b,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-ol;formic acid;prop-1-ene |
|---|---|
| PubChem CID | 144908713 |
| Molecular Formula | C30H52O3 |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 460.39 |
| IUPAC Name | (5aR)-3a,5a,8,8,11a-pentamethyl-2,3,4,5,5b,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-ol;formic acid;prop-1-ene |
| SMILES | C=CC.CC12CCCC1C1CCC3C(CCC4C(C)(C)C(O)CCC34C)[C@]1(C)CC2.O=CO |
| InChI | InChI=1S/C26H44O.C3H6.CH2O2/c1-23(2)21-11-10-19-20(26(21,5)14-12-22(23)27)9-8-18-17-7-6-13-24(17,3)15-16-25(18,19)4;1-3-2;2-1-3/h17-22,27H,6-16H2,1-5H3;3H,1H2,2H3;1H,(H,2,3)/t17?,18?,19?,20?,21?,22?,24?,25-,26?;;/m1../s1 |
| InChIKey | NKBYQOYQYLEBMX-OVSVRNMWSA-N |
| XLogP | 7.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|