C32H56O3 — CID 142271880
ethane;9-hydroxy-1,5b,8,8,11a-pentamethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carboxylic acid;prop-1-ene (PubChem CID 142271880) has the molecular formula C32H56O3 and a molecular weight of 488.80 g/mol. Its IUPAC name is ethane;9-hydroxy-1,5b,8,8,11a-pentamethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carboxylic acid;prop-1-ene.
| Compound Name | ethane;9-hydroxy-1,5b,8,8,11a-pentamethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carboxylic acid;prop-1-ene |
|---|---|
| PubChem CID | 142271880 |
| Molecular Formula | C32H56O3 |
| Molecular Weight | 488.80 g/mol |
| Exact Mass | 488.42 |
| IUPAC Name | ethane;9-hydroxy-1,5b,8,8,11a-pentamethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carboxylic acid;prop-1-ene |
| SMILES | C=CC.CC.CC1CCC2(C(=O)O)CCC3C(CCC4C3(C)CCC3C(C)(C)C(O)CCC34C)C12 |
| InChI | InChI=1S/C27H44O3.C3H6.C2H6/c1-16-8-14-27(23(29)30)15-9-18-17(22(16)27)6-7-20-25(18,4)12-10-19-24(2,3)21(28)11-13-26(19,20)5;1-3-2;1-2/h16-22,28H,6-15H2,1-5H3,(H,29,30);3H,1H2,2H3;1-2H3 |
| InChIKey | AKVGIPCTMYXNBP-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.80 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|