C29H48O — CID 143815750
1,5b,8,8,11a-pentamethyl-3a-[(E)-prop-1-enyl]-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-ol (PubChem CID 143815750) has the molecular formula C29H48O and a molecular weight of 412.70 g/mol. Its IUPAC name is 1,5b,8,8,11a-pentamethyl-3a-[(E)-prop-1-enyl]-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-ol.
| Compound Name | 1,5b,8,8,11a-pentamethyl-3a-[(E)-prop-1-enyl]-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-ol |
|---|---|
| PubChem CID | 143815750 |
| Molecular Formula | C29H48O |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 412.37 |
| IUPAC Name | 1,5b,8,8,11a-pentamethyl-3a-[(E)-prop-1-enyl]-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-ol |
| SMILES | C/C=C/C12CCC(C)C1C1CCC3C(C)(CCC4C(C)(C)C(O)CCC43C)C1CC2 |
| InChI | InChI=1S/C29H48O/c1-7-14-29-17-10-19(2)25(29)20-8-9-23-27(5,21(20)11-18-29)15-12-22-26(3,4)24(30)13-16-28(22,23)6/h7,14,19-25,30H,8-13,15-18H2,1-6H3/b14-7+ |
| InChIKey | WFSGMCXIFILZTR-VGOFMYFVSA-N |
| XLogP | 7.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|