C29H48O3 — CID 142106923
(1S,14R)-1,8,14,18,18-pentamethyl-6-(2-methylprop-1-enyl)-5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicosane-8,17-diol (PubChem CID 142106923) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is (1S,14R)-1,8,14,18,18-pentamethyl-6-(2-methylprop-1-enyl)-5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicosane-8,17-diol.
| Compound Name | (1S,14R)-1,8,14,18,18-pentamethyl-6-(2-methylprop-1-enyl)-5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicosane-8,17-diol |
|---|---|
| PubChem CID | 142106923 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | (1S,14R)-1,8,14,18,18-pentamethyl-6-(2-methylprop-1-enyl)-5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicosane-8,17-diol |
| SMILES | CC(C)=CC1CC(C)(O)C2C(CC3C2CCC2[C@@]3(C)CCC3C(C)(C)C(O)CC[C@@]32C)O1 |
| InChI | InChI=1S/C29H48O3/c1-17(2)14-18-16-29(7,31)25-19-8-9-23-27(5,20(19)15-21(25)32-18)12-10-22-26(3,4)24(30)11-13-28(22,23)6/h14,18-25,30-31H,8-13,15-16H2,1-7H3/t18?,19?,20?,21?,22?,23?,24?,25?,27-,28-,29?/m0/s1 |
| InChIKey | RIFDRALBTPSBAE-BQIDWRNCSA-N |
| XLogP | 6.13 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|