C38H60O3 — CID 144681840
benzyl (7aR,11bS,13bR)-9-hydroxy-5b,8,8,11a-tetramethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carboxylate;ethane;prop-1-ene (PubChem CID 144681840) has the molecular formula C38H60O3 and a molecular weight of 564.90 g/mol. Its IUPAC name is benzyl (7aR,11bS,13bR)-9-hydroxy-5b,8,8,11a-tetramethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carboxylate;ethane;prop-1-ene.
| Compound Name | benzyl (7aR,11bS,13bR)-9-hydroxy-5b,8,8,11a-tetramethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carboxylate;ethane;prop-1-ene |
|---|---|
| PubChem CID | 144681840 |
| Molecular Formula | C38H60O3 |
| Molecular Weight | 564.90 g/mol |
| Exact Mass | 564.45 |
| IUPAC Name | benzyl (7aR,11bS,13bR)-9-hydroxy-5b,8,8,11a-tetramethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carboxylate;ethane;prop-1-ene |
| SMILES | C=CC.CC.CC1(C)C(O)CCC2(C)[C@H]1CCC1(C)C3CCC4(C(=O)OCc5ccccc5)CCC[C@@H]4C3CC[C@@H]12 |
| InChI | InChI=1S/C33H48O3.C3H6.C2H6/c1-30(2)26-15-18-31(3)24-14-20-33(29(35)36-21-22-9-6-5-7-10-22)17-8-11-25(33)23(24)12-13-27(31)32(26,4)19-16-28(30)34;1-3-2;1-2/h5-7,9-10,23-28,34H,8,11-21H2,1-4H3;3H,1H2,2H3;1-2H3/t23?,24?,25-,26+,27+,28?,31?,32?,33?;;/m1../s1 |
| InChIKey | CDQGKAMNIMUNLU-OGSHHGQHSA-N |
| XLogP | 9.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.90 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|