C14H20O5 — CID 101121403
methyl (1S,2R,4R)-1-methoxy-2-(2-methoxy-2-oxoethyl)bicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 101121403) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is methyl (1S,2R,4R)-1-methoxy-2-(2-methoxy-2-oxoethyl)bicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | methyl (1S,2R,4R)-1-methoxy-2-(2-methoxy-2-oxoethyl)bicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 101121403 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | methyl (1S,2R,4R)-1-methoxy-2-(2-methoxy-2-oxoethyl)bicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | COC(=O)C[C@]1(C(=O)OC)C[C@@H]2C=C[C@@]1(OC)CC2 |
| InChI | InChI=1S/C14H20O5/c1-17-11(15)9-13(12(16)18-2)8-10-4-6-14(13,19-3)7-5-10/h4,6,10H,5,7-9H2,1-3H3/t10-,13+,14-/m1/s1 |
| InChIKey | IOFHEWTYTUKMQF-DDTOSNHZSA-N |
| XLogP | 1.46 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|