C21H16ClN3O4 — CID 10112203
methyl 3-[[8-chloro-3-(1H-indol-3-yl)-2-oxo-1H-quinolin-7-yl]amino]-3-oxopropanoate (PubChem CID 10112203) has the molecular formula C21H16ClN3O4 and a molecular weight of 409.83 g/mol. Its IUPAC name is methyl 3-[[8-chloro-3-(1H-indol-3-yl)-2-oxo-1H-quinolin-7-yl]amino]-3-oxopropanoate.
| Compound Name | methyl 3-[[8-chloro-3-(1H-indol-3-yl)-2-oxo-1H-quinolin-7-yl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 10112203 |
| Molecular Formula | C21H16ClN3O4 |
| Molecular Weight | 409.83 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | methyl 3-[[8-chloro-3-(1H-indol-3-yl)-2-oxo-1H-quinolin-7-yl]amino]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)Nc1ccc2cc(-c3c[nH]c4ccccc34)c(=O)[nH]c2c1Cl |
| InChI | InChI=1S/C21H16ClN3O4/c1-29-18(27)9-17(26)24-16-7-6-11-8-13(21(28)25-20(11)19(16)22)14-10-23-15-5-3-2-4-12(14)15/h2-8,10,23H,9H2,1H3,(H,24,26)(H,25,28) |
| InChIKey | AJGFFDVEDKVRFQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.83 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|