C25H17Cl2N3O3 — CID 10299345
(3,4-dichlorophenyl)methyl N-[3-(1H-indol-3-yl)-2-oxo-1H-quinolin-7-yl]carbamate (PubChem CID 10299345) has the molecular formula C25H17Cl2N3O3 and a molecular weight of 478.34 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl N-[3-(1H-indol-3-yl)-2-oxo-1H-quinolin-7-yl]carbamate.
| Compound Name | (3,4-dichlorophenyl)methyl N-[3-(1H-indol-3-yl)-2-oxo-1H-quinolin-7-yl]carbamate |
|---|---|
| PubChem CID | 10299345 |
| Molecular Formula | C25H17Cl2N3O3 |
| Molecular Weight | 478.34 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | (3,4-dichlorophenyl)methyl N-[3-(1H-indol-3-yl)-2-oxo-1H-quinolin-7-yl]carbamate |
| SMILES | O=C(Nc1ccc2cc(-c3c[nH]c4ccccc34)c(=O)[nH]c2c1)OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H17Cl2N3O3/c26-20-8-5-14(9-21(20)27)13-33-25(32)29-16-7-6-15-10-18(24(31)30-23(15)11-16)19-12-28-22-4-2-1-3-17(19)22/h1-12,28H,13H2,(H,29,32)(H,30,31) |
| InChIKey | YRPGGZJWVRRVOV-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.34 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |