C32H50O6 — CID 101122487
8-[4-[4-(2,3-dihydroxypropoxy)-3-nonylphenyl]phenoxy]octane-1,2-diol (PubChem CID 101122487) has the molecular formula C32H50O6 and a molecular weight of 530.75 g/mol. Its IUPAC name is 8-[4-[4-(2,3-dihydroxypropoxy)-3-nonylphenyl]phenoxy]octane-1,2-diol.
| Compound Name | 8-[4-[4-(2,3-dihydroxypropoxy)-3-nonylphenyl]phenoxy]octane-1,2-diol |
|---|---|
| PubChem CID | 101122487 |
| Molecular Formula | C32H50O6 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | 8-[4-[4-(2,3-dihydroxypropoxy)-3-nonylphenyl]phenoxy]octane-1,2-diol |
| SMILES | CCCCCCCCCc1cc(-c2ccc(OCCCCCCC(O)CO)cc2)ccc1OCC(O)CO |
| InChI | InChI=1S/C32H50O6/c1-2-3-4-5-6-7-10-13-28-22-27(17-20-32(28)38-25-30(36)24-34)26-15-18-31(19-16-26)37-21-12-9-8-11-14-29(35)23-33/h15-20,22,29-30,33-36H,2-14,21,23-25H2,1H3 |
| InChIKey | IKGMUHUFGTXVIH-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|