C30H42N4O5 — CID 101123214
(2S)-1-[(2S,4R)-4-benzyl-5-[[(1S,2S)-2,3-dihydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-hydroxy-5-oxopentyl]-N-tert-butylpiperazine-2-carboxamide (PubChem CID 101123214) has the molecular formula C30H42N4O5 and a molecular weight of 538.69 g/mol. Its IUPAC name is (2S)-1-[(2S,4R)-4-benzyl-5-[[(1S,2S)-2,3-dihydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-hydroxy-5-oxopentyl]-N-tert-butylpiperazine-2-carboxamide.
| Compound Name | (2S)-1-[(2S,4R)-4-benzyl-5-[[(1S,2S)-2,3-dihydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-hydroxy-5-oxopentyl]-N-tert-butylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 101123214 |
| Molecular Formula | C30H42N4O5 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.32 |
| IUPAC Name | (2S)-1-[(2S,4R)-4-benzyl-5-[[(1S,2S)-2,3-dihydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-hydroxy-5-oxopentyl]-N-tert-butylpiperazine-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@@H]1CNCCN1C[C@@H](O)C[C@@H](Cc1ccccc1)C(=O)N[C@H]1c2ccccc2C(O)[C@H]1O |
| InChI | InChI=1S/C30H42N4O5/c1-30(2,3)33-29(39)24-17-31-13-14-34(24)18-21(35)16-20(15-19-9-5-4-6-10-19)28(38)32-25-22-11-7-8-12-23(22)26(36)27(25)37/h4-12,20-21,24-27,31,35-37H,13-18H2,1-3H3,(H,32,38)(H,33,39)/t20-,21+,24+,25+,26?,27+/m1/s1 |
| InChIKey | PJHHYTNSIOUCMX-UZGHKGKXSA-N |
| XLogP | 1.05 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |