C11H14BrNO2S3 — CID 101124249
(4-bromophenyl)sulfonyl N,N-diethylcarbamodithioate (PubChem CID 101124249) has the molecular formula C11H14BrNO2S3 and a molecular weight of 368.34 g/mol. Its IUPAC name is (4-bromophenyl)sulfonyl N,N-diethylcarbamodithioate.
| Compound Name | (4-bromophenyl)sulfonyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 101124249 |
| Molecular Formula | C11H14BrNO2S3 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 366.94 |
| IUPAC Name | (4-bromophenyl)sulfonyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H14BrNO2S3/c1-3-13(4-2)11(16)17-18(14,15)10-7-5-9(12)6-8-10/h5-8H,3-4H2,1-2H3 |
| InChIKey | KZLKABZCUXKRMR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|