C59H107N12O13 — CID 101124297
CID 101124297 (PubChem CID 101124297) has the molecular formula C59H107N12O13 and a molecular weight of 1192.58 g/mol.
| Compound Name | CID 101124297 |
|---|---|
| PubChem CID | 101124297 |
| Molecular Formula | C59H107N12O13 |
| Molecular Weight | 1192.58 g/mol |
| Exact Mass | 1191.81 |
| IUPAC Name | — |
| SMILES | CCCCCCCCNC(C)(C)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)NC(C)(C)C(=O)NCC(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)NC1(C(=O)NCC(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)OC)C(C)CC)CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C59H107N12O13/c1-19-21-22-23-24-25-26-64-57(14,15)52(80)62-32-45(74)65-40(27-36(3)4)48(76)69-58(16,17)53(81)61-30-43(72)60-31-44(73)66-41(28-37(5)6)49(77)70-59(34-55(10,11)71(83)56(12,13)35-59)54(82)63-33-46(75)68-47(39(9)20-2)50(78)67-42(29-38(7)8)51(79)84-18/h36-42,47,64H,19-35H2,1-18H3,(H,60,72)(H,61,81)(H,62,80)(H,63,82)(H,65,74)(H,66,73)(H,67,78)(H,68,75)(H,69,76)(H,70,77)/t39?,40-,41-,42-,47-/m0/s1 |
| InChIKey | HHRPDQNQJAQOEL-SONOUURTSA-N |
| XLogP | 2.22 |
| TPSA | 352.47 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1192.58 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|