C10H12O5 — CID 101124631
(2R)-2-[(1S,2R,4R,5S)-4-methoxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-4-methyl-2H-furan-5-one (PubChem CID 101124631) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is (2R)-2-[(1S,2R,4R,5S)-4-methoxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-4-methyl-2H-furan-5-one.
| Compound Name | (2R)-2-[(1S,2R,4R,5S)-4-methoxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-4-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 101124631 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (2R)-2-[(1S,2R,4R,5S)-4-methoxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-4-methyl-2H-furan-5-one |
| SMILES | CO[C@@H]1O[C@H]([C@H]2C=C(C)C(=O)O2)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C10H12O5/c1-4-3-5(13-9(4)11)6-7-8(14-7)10(12-2)15-6/h3,5-8,10H,1-2H3/t5-,6-,7+,8+,10-/m1/s1 |
| InChIKey | XHMNCLBOUXRXAQ-OPJPCFLTSA-N |
| XLogP | -0.00 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|