C17H22O3S — CID 101125685
propan-2-yl 2-[(1R)-2-(4-methylphenyl)sulfinylcyclopent-2-en-1-yl]acetate (PubChem CID 101125685) has the molecular formula C17H22O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is propan-2-yl 2-[(1R)-2-(4-methylphenyl)sulfinylcyclopent-2-en-1-yl]acetate.
| Compound Name | propan-2-yl 2-[(1R)-2-(4-methylphenyl)sulfinylcyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 101125685 |
| Molecular Formula | C17H22O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | propan-2-yl 2-[(1R)-2-(4-methylphenyl)sulfinylcyclopent-2-en-1-yl]acetate |
| SMILES | Cc1ccc(S(=O)C2=CCC[C@@H]2CC(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C17H22O3S/c1-12(2)20-17(18)11-14-5-4-6-16(14)21(19)15-9-7-13(3)8-10-15/h6-10,12,14H,4-5,11H2,1-3H3/t14-,21?/m1/s1 |
| InChIKey | QSROFWIRHZURLC-CKAQCJTGSA-N |
| XLogP | 3.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |